C33H34N4O4S — CID 68848710
[5-[(4-tert-butylphenyl)sulfonylamino]-3-phenyl-1H-indol-2-yl] N-[4-(dimethylamino)phenyl]carbamate (PubChem CID 68848710) has the molecular formula C33H34N4O4S and a molecular weight of 582.73 g/mol. Its IUPAC name is [5-[(4-tert-butylphenyl)sulfonylamino]-3-phenyl-1H-indol-2-yl] N-[4-(dimethylamino)phenyl]carbamate.
| Compound Name | [5-[(4-tert-butylphenyl)sulfonylamino]-3-phenyl-1H-indol-2-yl] N-[4-(dimethylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 68848710 |
| Molecular Formula | C33H34N4O4S |
| Molecular Weight | 582.73 g/mol |
| Exact Mass | 582.23 |
| IUPAC Name | [5-[(4-tert-butylphenyl)sulfonylamino]-3-phenyl-1H-indol-2-yl] N-[4-(dimethylamino)phenyl]carbamate |
| SMILES | CN(C)c1ccc(NC(=O)Oc2[nH]c3ccc(NS(=O)(=O)c4ccc(C(C)(C)C)cc4)cc3c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C33H34N4O4S/c1-33(2,3)23-11-18-27(19-12-23)42(39,40)36-25-15-20-29-28(21-25)30(22-9-7-6-8-10-22)31(35-29)41-32(38)34-24-13-16-26(17-14-24)37(4)5/h6-21,35-36H,1-5H3,(H,34,38) |
| InChIKey | YRCLEFKNERRYCL-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.73 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|