C30H28N4O4S — CID 68849123
[5-[(4-tert-butylphenyl)sulfonylamino]-3-phenyl-1H-indol-2-yl] N-pyridin-3-ylcarbamate (PubChem CID 68849123) has the molecular formula C30H28N4O4S and a molecular weight of 540.65 g/mol. Its IUPAC name is [5-[(4-tert-butylphenyl)sulfonylamino]-3-phenyl-1H-indol-2-yl] N-pyridin-3-ylcarbamate.
| Compound Name | [5-[(4-tert-butylphenyl)sulfonylamino]-3-phenyl-1H-indol-2-yl] N-pyridin-3-ylcarbamate |
|---|---|
| PubChem CID | 68849123 |
| Molecular Formula | C30H28N4O4S |
| Molecular Weight | 540.65 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | [5-[(4-tert-butylphenyl)sulfonylamino]-3-phenyl-1H-indol-2-yl] N-pyridin-3-ylcarbamate |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc3[nH]c(OC(=O)Nc4cccnc4)c(-c4ccccc4)c3c2)cc1 |
| InChI | InChI=1S/C30H28N4O4S/c1-30(2,3)21-11-14-24(15-12-21)39(36,37)34-22-13-16-26-25(18-22)27(20-8-5-4-6-9-20)28(33-26)38-29(35)32-23-10-7-17-31-19-23/h4-19,33-34H,1-3H3,(H,32,35) |
| InChIKey | AIYSKCKHNJTJHV-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.65 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |