C34H30N4O4S — CID 68848078
[5-[(4-tert-butylphenyl)sulfonylamino]-3-phenyl-1H-indol-2-yl] N-quinolin-5-ylcarbamate (PubChem CID 68848078) has the molecular formula C34H30N4O4S and a molecular weight of 590.71 g/mol. Its IUPAC name is [5-[(4-tert-butylphenyl)sulfonylamino]-3-phenyl-1H-indol-2-yl] N-quinolin-5-ylcarbamate.
| Compound Name | [5-[(4-tert-butylphenyl)sulfonylamino]-3-phenyl-1H-indol-2-yl] N-quinolin-5-ylcarbamate |
|---|---|
| PubChem CID | 68848078 |
| Molecular Formula | C34H30N4O4S |
| Molecular Weight | 590.71 g/mol |
| Exact Mass | 590.20 |
| IUPAC Name | [5-[(4-tert-butylphenyl)sulfonylamino]-3-phenyl-1H-indol-2-yl] N-quinolin-5-ylcarbamate |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc3[nH]c(OC(=O)Nc4cccc5ncccc45)c(-c4ccccc4)c3c2)cc1 |
| InChI | InChI=1S/C34H30N4O4S/c1-34(2,3)23-14-17-25(18-15-23)43(40,41)38-24-16-19-30-27(21-24)31(22-9-5-4-6-10-22)32(36-30)42-33(39)37-29-13-7-12-28-26(29)11-8-20-35-28/h4-21,36,38H,1-3H3,(H,37,39) |
| InChIKey | ZYUIGBUHIMXVMD-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.71 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |