C32H31N3O4S — CID 68848009
[5-[(4-tert-butylphenyl)sulfonylamino]-3-phenyl-1H-indol-2-yl] N-benzylcarbamate (PubChem CID 68848009) has the molecular formula C32H31N3O4S and a molecular weight of 553.68 g/mol. Its IUPAC name is [5-[(4-tert-butylphenyl)sulfonylamino]-3-phenyl-1H-indol-2-yl] N-benzylcarbamate.
| Compound Name | [5-[(4-tert-butylphenyl)sulfonylamino]-3-phenyl-1H-indol-2-yl] N-benzylcarbamate |
|---|---|
| PubChem CID | 68848009 |
| Molecular Formula | C32H31N3O4S |
| Molecular Weight | 553.68 g/mol |
| Exact Mass | 553.20 |
| IUPAC Name | [5-[(4-tert-butylphenyl)sulfonylamino]-3-phenyl-1H-indol-2-yl] N-benzylcarbamate |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc3[nH]c(OC(=O)NCc4ccccc4)c(-c4ccccc4)c3c2)cc1 |
| InChI | InChI=1S/C32H31N3O4S/c1-32(2,3)24-14-17-26(18-15-24)40(37,38)35-25-16-19-28-27(20-25)29(23-12-8-5-9-13-23)30(34-28)39-31(36)33-21-22-10-6-4-7-11-22/h4-20,34-35H,21H2,1-3H3,(H,33,36) |
| InChIKey | USAPXTJMIHNVHZ-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.68 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |