C25H25N3O6S2 — CID 68848390
[5-[(4-methylsulfonylphenyl)sulfonylamino]-3-phenyl-1H-indol-2-yl] N-propylcarbamate (PubChem CID 68848390) has the molecular formula C25H25N3O6S2 and a molecular weight of 527.62 g/mol. Its IUPAC name is [5-[(4-methylsulfonylphenyl)sulfonylamino]-3-phenyl-1H-indol-2-yl] N-propylcarbamate.
| Compound Name | [5-[(4-methylsulfonylphenyl)sulfonylamino]-3-phenyl-1H-indol-2-yl] N-propylcarbamate |
|---|---|
| PubChem CID | 68848390 |
| Molecular Formula | C25H25N3O6S2 |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.12 |
| IUPAC Name | [5-[(4-methylsulfonylphenyl)sulfonylamino]-3-phenyl-1H-indol-2-yl] N-propylcarbamate |
| SMILES | CCCNC(=O)Oc1[nH]c2ccc(NS(=O)(=O)c3ccc(S(C)(=O)=O)cc3)cc2c1-c1ccccc1 |
| InChI | InChI=1S/C25H25N3O6S2/c1-3-15-26-25(29)34-24-23(17-7-5-4-6-8-17)21-16-18(9-14-22(21)27-24)28-36(32,33)20-12-10-19(11-13-20)35(2,30)31/h4-14,16,27-28H,3,15H2,1-2H3,(H,26,29) |
| InChIKey | ADBUSCKNRZOMJZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 134.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |