C32H37N3O3S — CID 58622331
5-[(4-tert-butylphenyl)sulfonylamino]-N-cycloheptyl-3-phenyl-1H-indole-2-carboxamide (PubChem CID 58622331) has the molecular formula C32H37N3O3S and a molecular weight of 543.73 g/mol. Its IUPAC name is 5-[(4-tert-butylphenyl)sulfonylamino]-N-cycloheptyl-3-phenyl-1H-indole-2-carboxamide.
| Compound Name | 5-[(4-tert-butylphenyl)sulfonylamino]-N-cycloheptyl-3-phenyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 58622331 |
| Molecular Formula | C32H37N3O3S |
| Molecular Weight | 543.73 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | 5-[(4-tert-butylphenyl)sulfonylamino]-N-cycloheptyl-3-phenyl-1H-indole-2-carboxamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc3[nH]c(C(=O)NC4CCCCCC4)c(-c4ccccc4)c3c2)cc1 |
| InChI | InChI=1S/C32H37N3O3S/c1-32(2,3)23-15-18-26(19-16-23)39(37,38)35-25-17-20-28-27(21-25)29(22-11-7-6-8-12-22)30(34-28)31(36)33-24-13-9-4-5-10-14-24/h6-8,11-12,15-21,24,34-35H,4-5,9-10,13-14H2,1-3H3,(H,33,36) |
| InChIKey | OPZLPJBASURUQQ-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.73 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |