C32H34N2O3S — CID 143202698
4-tert-butyl-N-[2-[3-(cyclopropylmethyl)but-3-enoyl]-3-phenyl-1H-indol-5-yl]benzenesulfonamide (PubChem CID 143202698) has the molecular formula C32H34N2O3S and a molecular weight of 526.70 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-[3-(cyclopropylmethyl)but-3-enoyl]-3-phenyl-1H-indol-5-yl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[2-[3-(cyclopropylmethyl)but-3-enoyl]-3-phenyl-1H-indol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 143202698 |
| Molecular Formula | C32H34N2O3S |
| Molecular Weight | 526.70 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | 4-tert-butyl-N-[2-[3-(cyclopropylmethyl)but-3-enoyl]-3-phenyl-1H-indol-5-yl]benzenesulfonamide |
| SMILES | C=C(CC(=O)c1[nH]c2ccc(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)cc2c1-c1ccccc1)CC1CC1 |
| InChI | InChI=1S/C32H34N2O3S/c1-21(18-22-10-11-22)19-29(35)31-30(23-8-6-5-7-9-23)27-20-25(14-17-28(27)33-31)34-38(36,37)26-15-12-24(13-16-26)32(2,3)4/h5-9,12-17,20,22,33-34H,1,10-11,18-19H2,2-4H3 |
| InChIKey | ABFLSMOPNVHJGO-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.70 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|