C36H40N2O3S — CID 143202674
4-tert-butyl-N-[2-[2-(cyclohept-3-en-1-ylmethyl)cyclopropanecarbonyl]-3-phenyl-1H-indol-5-yl]benzenesulfonamide (PubChem CID 143202674) has the molecular formula C36H40N2O3S and a molecular weight of 580.79 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-[2-(cyclohept-3-en-1-ylmethyl)cyclopropanecarbonyl]-3-phenyl-1H-indol-5-yl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[2-[2-(cyclohept-3-en-1-ylmethyl)cyclopropanecarbonyl]-3-phenyl-1H-indol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 143202674 |
| Molecular Formula | C36H40N2O3S |
| Molecular Weight | 580.79 g/mol |
| Exact Mass | 580.28 |
| IUPAC Name | 4-tert-butyl-N-[2-[2-(cyclohept-3-en-1-ylmethyl)cyclopropanecarbonyl]-3-phenyl-1H-indol-5-yl]benzenesulfonamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc3[nH]c(C(=O)C4CC4CC4CC=CCCC4)c(-c4ccccc4)c3c2)cc1 |
| InChI | InChI=1S/C36H40N2O3S/c1-36(2,3)27-15-18-29(19-16-27)42(40,41)38-28-17-20-32-31(23-28)33(25-13-9-6-10-14-25)34(37-32)35(39)30-22-26(30)21-24-11-7-4-5-8-12-24/h4,6-7,9-10,13-20,23-24,26,30,37-38H,5,8,11-12,21-22H2,1-3H3 |
| InChIKey | CQXIQGIWEPEQJO-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.79 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|