C30H36N4O3S — CID 58622313
5-[(4-tert-butylphenyl)sulfonylamino]-N-[3-(dimethylamino)propyl]-3-phenyl-1H-indole-2-carboxamide (PubChem CID 58622313) has the molecular formula C30H36N4O3S and a molecular weight of 532.71 g/mol. Its IUPAC name is 5-[(4-tert-butylphenyl)sulfonylamino]-N-[3-(dimethylamino)propyl]-3-phenyl-1H-indole-2-carboxamide.
| Compound Name | 5-[(4-tert-butylphenyl)sulfonylamino]-N-[3-(dimethylamino)propyl]-3-phenyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 58622313 |
| Molecular Formula | C30H36N4O3S |
| Molecular Weight | 532.71 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | 5-[(4-tert-butylphenyl)sulfonylamino]-N-[3-(dimethylamino)propyl]-3-phenyl-1H-indole-2-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1[nH]c2ccc(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)cc2c1-c1ccccc1 |
| InChI | InChI=1S/C30H36N4O3S/c1-30(2,3)22-12-15-24(16-13-22)38(36,37)33-23-14-17-26-25(20-23)27(21-10-7-6-8-11-21)28(32-26)29(35)31-18-9-19-34(4)5/h6-8,10-17,20,32-33H,9,18-19H2,1-5H3,(H,31,35) |
| InChIKey | YEJDFIUZWQBEMN-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.71 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|