C25H23FN2O4S — CID 69246004
5-[(4-tert-butylphenyl)sulfonylamino]-3-(2-fluorophenyl)-1H-indole-2-carboxylic acid (PubChem CID 69246004) has the molecular formula C25H23FN2O4S and a molecular weight of 466.53 g/mol. Its IUPAC name is 5-[(4-tert-butylphenyl)sulfonylamino]-3-(2-fluorophenyl)-1H-indole-2-carboxylic acid.
| Compound Name | 5-[(4-tert-butylphenyl)sulfonylamino]-3-(2-fluorophenyl)-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 69246004 |
| Molecular Formula | C25H23FN2O4S |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 5-[(4-tert-butylphenyl)sulfonylamino]-3-(2-fluorophenyl)-1H-indole-2-carboxylic acid |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc3[nH]c(C(=O)O)c(-c4ccccc4F)c3c2)cc1 |
| InChI | InChI=1S/C25H23FN2O4S/c1-25(2,3)15-8-11-17(12-9-15)33(31,32)28-16-10-13-21-19(14-16)22(23(27-21)24(29)30)18-6-4-5-7-20(18)26/h4-14,27-28H,1-3H3,(H,29,30) |
| InChIKey | QRDMQQLINFZJFH-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |