C23H15F4NO2 — CID 135386772
methyl 6-(4-fluorophenyl)-3-[4-(trifluoromethyl)phenyl]-1H-indole-2-carboxylate (PubChem CID 135386772) has the molecular formula C23H15F4NO2 and a molecular weight of 413.37 g/mol. Its IUPAC name is methyl 6-(4-fluorophenyl)-3-[4-(trifluoromethyl)phenyl]-1H-indole-2-carboxylate.
| Compound Name | methyl 6-(4-fluorophenyl)-3-[4-(trifluoromethyl)phenyl]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 135386772 |
| Molecular Formula | C23H15F4NO2 |
| Molecular Weight | 413.37 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | methyl 6-(4-fluorophenyl)-3-[4-(trifluoromethyl)phenyl]-1H-indole-2-carboxylate |
| SMILES | COC(=O)c1[nH]c2cc(-c3ccc(F)cc3)ccc2c1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H15F4NO2/c1-30-22(29)21-20(14-2-7-16(8-3-14)23(25,26)27)18-11-6-15(12-19(18)28-21)13-4-9-17(24)10-5-13/h2-12,28H,1H3 |
| InChIKey | YSZOSQUHTPONPI-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.37 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |