C27H28F2N4O — CID 154944429
N-(2,5-diaminohexyl)-3,6-bis(4-fluorophenyl)-1H-indole-2-carboxamide (PubChem CID 154944429) has the molecular formula C27H28F2N4O and a molecular weight of 462.54 g/mol. Its IUPAC name is N-(2,5-diaminohexyl)-3,6-bis(4-fluorophenyl)-1H-indole-2-carboxamide.
| Compound Name | N-(2,5-diaminohexyl)-3,6-bis(4-fluorophenyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 154944429 |
| Molecular Formula | C27H28F2N4O |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | N-(2,5-diaminohexyl)-3,6-bis(4-fluorophenyl)-1H-indole-2-carboxamide |
| SMILES | CC(N)CCC(N)CNC(=O)c1[nH]c2cc(-c3ccc(F)cc3)ccc2c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C27H28F2N4O/c1-16(30)2-12-22(31)15-32-27(34)26-25(18-5-10-21(29)11-6-18)23-13-7-19(14-24(23)33-26)17-3-8-20(28)9-4-17/h3-11,13-14,16,22,33H,2,12,15,30-31H2,1H3,(H,32,34) |
| InChIKey | JNQVSHVDQBAKOV-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 96.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |