C25H29Cl2FN4O — CID 154944440
3-(2-cyclopropylethynyl)-N-(2,5-diaminopentyl)-6-(4-fluorophenyl)-1H-indole-2-carboxamide;dihydrochloride (PubChem CID 154944440) has the molecular formula C25H29Cl2FN4O and a molecular weight of 491.44 g/mol. Its IUPAC name is 3-(2-cyclopropylethynyl)-N-(2,5-diaminopentyl)-6-(4-fluorophenyl)-1H-indole-2-carboxamide;dihydrochloride.
| Compound Name | 3-(2-cyclopropylethynyl)-N-(2,5-diaminopentyl)-6-(4-fluorophenyl)-1H-indole-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 154944440 |
| Molecular Formula | C25H29Cl2FN4O |
| Molecular Weight | 491.44 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | 3-(2-cyclopropylethynyl)-N-(2,5-diaminopentyl)-6-(4-fluorophenyl)-1H-indole-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NCCCC(N)CNC(=O)c1[nH]c2cc(-c3ccc(F)cc3)ccc2c1C#CC1CC1 |
| InChI | InChI=1S/C25H27FN4O.2ClH/c26-19-9-6-17(7-10-19)18-8-12-21-22(11-5-16-3-4-16)24(30-23(21)14-18)25(31)29-15-20(28)2-1-13-27;;/h6-10,12,14,16,20,30H,1-4,13,15,27-28H2,(H,29,31);2*1H |
| InChIKey | XKXLFDDJIZVRCL-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 96.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|