C26H28F2N5O+ — CID 153489434
N-[(2S)-2,5-diaminopentyl]-6-(4-fluorophenyl)-3-[(4-fluorophenyl)methyl]-1H-benzimidazol-3-ium-2-carboxamide (PubChem CID 153489434) has the molecular formula C26H28F2N5O+ and a molecular weight of 464.54 g/mol. Its IUPAC name is N-[(2S)-2,5-diaminopentyl]-6-(4-fluorophenyl)-3-[(4-fluorophenyl)methyl]-1H-benzimidazol-3-ium-2-carboxamide.
| Compound Name | N-[(2S)-2,5-diaminopentyl]-6-(4-fluorophenyl)-3-[(4-fluorophenyl)methyl]-1H-benzimidazol-3-ium-2-carboxamide |
|---|---|
| PubChem CID | 153489434 |
| Molecular Formula | C26H28F2N5O+ |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | N-[(2S)-2,5-diaminopentyl]-6-(4-fluorophenyl)-3-[(4-fluorophenyl)methyl]-1H-benzimidazol-3-ium-2-carboxamide |
| SMILES | NCCC[C@H](N)CNC(=O)c1[nH]c2cc(-c3ccc(F)cc3)ccc2[n+]1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C26H27F2N5O/c27-20-8-3-17(4-9-20)16-33-24-12-7-19(18-5-10-21(28)11-6-18)14-23(24)32-25(33)26(34)31-15-22(30)2-1-13-29/h3-12,14,22H,1-2,13,15-16,29-30H2,(H,31,34)/p+1/t22-/m0/s1 |
| InChIKey | ZFPKQBJFBHABKN-QFIPXVFZSA-O |
| XLogP | 3.24 |
| TPSA | 100.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|