C25H24FN3O3 — CID 142485636
tert-butyl N-[[3-(2-cyclopropylethynyl)-6-(4-fluorophenyl)-1H-indole-2-carbonyl]amino]carbamate (PubChem CID 142485636) has the molecular formula C25H24FN3O3 and a molecular weight of 433.48 g/mol. Its IUPAC name is tert-butyl N-[[3-(2-cyclopropylethynyl)-6-(4-fluorophenyl)-1H-indole-2-carbonyl]amino]carbamate.
| Compound Name | tert-butyl N-[[3-(2-cyclopropylethynyl)-6-(4-fluorophenyl)-1H-indole-2-carbonyl]amino]carbamate |
|---|---|
| PubChem CID | 142485636 |
| Molecular Formula | C25H24FN3O3 |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | tert-butyl N-[[3-(2-cyclopropylethynyl)-6-(4-fluorophenyl)-1H-indole-2-carbonyl]amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNC(=O)c1[nH]c2cc(-c3ccc(F)cc3)ccc2c1C#CC1CC1 |
| InChI | InChI=1S/C25H24FN3O3/c1-25(2,3)32-24(31)29-28-23(30)22-20(12-6-15-4-5-15)19-13-9-17(14-21(19)27-22)16-7-10-18(26)11-8-16/h7-11,13-15,27H,4-5H2,1-3H3,(H,28,30)(H,29,31) |
| InChIKey | NBTVTACKTABGSG-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|