C15H21FN2O2 — CID 107237014
tert-butyl N-[[cyclopropyl-(4-fluorophenyl)methyl]amino]carbamate (PubChem CID 107237014) has the molecular formula C15H21FN2O2 and a molecular weight of 280.34 g/mol. Its IUPAC name is tert-butyl N-[[cyclopropyl-(4-fluorophenyl)methyl]amino]carbamate.
| Compound Name | tert-butyl N-[[cyclopropyl-(4-fluorophenyl)methyl]amino]carbamate |
|---|---|
| PubChem CID | 107237014 |
| Molecular Formula | C15H21FN2O2 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | tert-butyl N-[[cyclopropyl-(4-fluorophenyl)methyl]amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNC(c1ccc(F)cc1)C1CC1 |
| InChI | InChI=1S/C15H21FN2O2/c1-15(2,3)20-14(19)18-17-13(10-4-5-10)11-6-8-12(16)9-7-11/h6-10,13,17H,4-5H2,1-3H3,(H,18,19) |
| InChIKey | IXQWXRQMDDGOIA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|