C17H14F3NO4 — CID 55855159
N-[2-[4-(trifluoromethyl)phenoxy]ethyl]-1,3-benzodioxole-4-carboxamide (PubChem CID 55855159) has the molecular formula C17H14F3NO4 and a molecular weight of 353.30 g/mol. Its IUPAC name is N-[2-[4-(trifluoromethyl)phenoxy]ethyl]-1,3-benzodioxole-4-carboxamide.
| Compound Name | N-[2-[4-(trifluoromethyl)phenoxy]ethyl]-1,3-benzodioxole-4-carboxamide |
|---|---|
| PubChem CID | 55855159 |
| Molecular Formula | C17H14F3NO4 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | N-[2-[4-(trifluoromethyl)phenoxy]ethyl]-1,3-benzodioxole-4-carboxamide |
| SMILES | O=C(NCCOc1ccc(C(F)(F)F)cc1)c1cccc2c1OCO2 |
| InChI | InChI=1S/C17H14F3NO4/c18-17(19,20)11-4-6-12(7-5-11)23-9-8-21-16(22)13-2-1-3-14-15(13)25-10-24-14/h1-7H,8-10H2,(H,21,22) |
| InChIKey | XINWGPGKDKWCGW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|