C20H20F3NO4S — CID 55882246
methyl 2-[2-[2-[4-(trifluoromethyl)phenoxy]ethylcarbamoyl]phenyl]sulfanylpropanoate (PubChem CID 55882246) has the molecular formula C20H20F3NO4S and a molecular weight of 427.44 g/mol. Its IUPAC name is methyl 2-[2-[2-[4-(trifluoromethyl)phenoxy]ethylcarbamoyl]phenyl]sulfanylpropanoate.
| Compound Name | methyl 2-[2-[2-[4-(trifluoromethyl)phenoxy]ethylcarbamoyl]phenyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 55882246 |
| Molecular Formula | C20H20F3NO4S |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | methyl 2-[2-[2-[4-(trifluoromethyl)phenoxy]ethylcarbamoyl]phenyl]sulfanylpropanoate |
| SMILES | COC(=O)C(C)Sc1ccccc1C(=O)NCCOc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H20F3NO4S/c1-13(19(26)27-2)29-17-6-4-3-5-16(17)18(25)24-11-12-28-15-9-7-14(8-10-15)20(21,22)23/h3-10,13H,11-12H2,1-2H3,(H,24,25) |
| InChIKey | WCUDTVRKEABHIL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|