C19H20N2O4S — CID 51121031
methyl 2-[2-[(4-carbamoylphenyl)methylcarbamoyl]phenyl]sulfanylpropanoate (PubChem CID 51121031) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is methyl 2-[2-[(4-carbamoylphenyl)methylcarbamoyl]phenyl]sulfanylpropanoate.
| Compound Name | methyl 2-[2-[(4-carbamoylphenyl)methylcarbamoyl]phenyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 51121031 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | methyl 2-[2-[(4-carbamoylphenyl)methylcarbamoyl]phenyl]sulfanylpropanoate |
| SMILES | COC(=O)C(C)Sc1ccccc1C(=O)NCc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C19H20N2O4S/c1-12(19(24)25-2)26-16-6-4-3-5-15(16)18(23)21-11-13-7-9-14(10-8-13)17(20)22/h3-10,12H,11H2,1-2H3,(H2,20,22)(H,21,23) |
| InChIKey | JMEMDPKEYJLMFW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |