C17H24N2O4S — CID 51121045
methyl 2-[2-[[1-oxo-1-(propylamino)propan-2-yl]carbamoyl]phenyl]sulfanylpropanoate (PubChem CID 51121045) has the molecular formula C17H24N2O4S and a molecular weight of 352.46 g/mol. Its IUPAC name is methyl 2-[2-[[1-oxo-1-(propylamino)propan-2-yl]carbamoyl]phenyl]sulfanylpropanoate.
| Compound Name | methyl 2-[2-[[1-oxo-1-(propylamino)propan-2-yl]carbamoyl]phenyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 51121045 |
| Molecular Formula | C17H24N2O4S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | methyl 2-[2-[[1-oxo-1-(propylamino)propan-2-yl]carbamoyl]phenyl]sulfanylpropanoate |
| SMILES | CCCNC(=O)C(C)NC(=O)c1ccccc1SC(C)C(=O)OC |
| InChI | InChI=1S/C17H24N2O4S/c1-5-10-18-15(20)11(2)19-16(21)13-8-6-7-9-14(13)24-12(3)17(22)23-4/h6-9,11-12H,5,10H2,1-4H3,(H,18,20)(H,19,21) |
| InChIKey | ADNYRPASIRNTFT-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |