C25H24N4O3S2 — CID 31527069
N-[4-(1,3-benzothiazol-2-yl)phenyl]-3-(4-methylpiperazin-1-yl)sulfonylbenzamide (PubChem CID 31527069) has the molecular formula C25H24N4O3S2 and a molecular weight of 492.63 g/mol. Its IUPAC name is N-[4-(1,3-benzothiazol-2-yl)phenyl]-3-(4-methylpiperazin-1-yl)sulfonylbenzamide.
| Compound Name | N-[4-(1,3-benzothiazol-2-yl)phenyl]-3-(4-methylpiperazin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 31527069 |
| Molecular Formula | C25H24N4O3S2 |
| Molecular Weight | 492.63 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | N-[4-(1,3-benzothiazol-2-yl)phenyl]-3-(4-methylpiperazin-1-yl)sulfonylbenzamide |
| SMILES | CN1CCN(S(=O)(=O)c2cccc(C(=O)Nc3ccc(-c4nc5ccccc5s4)cc3)c2)CC1 |
| InChI | InChI=1S/C25H24N4O3S2/c1-28-13-15-29(16-14-28)34(31,32)21-6-4-5-19(17-21)24(30)26-20-11-9-18(10-12-20)25-27-22-7-2-3-8-23(22)33-25/h2-12,17H,13-16H2,1H3,(H,26,30) |
| InChIKey | OQJALYWKIFSESD-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.63 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |