C21H25N3O2S — CID 174362978
N-[4-(1,3-benzothiazol-2-yl)phenyl]-4-[(1-hydroxy-2-methylpropyl)amino]butanamide (PubChem CID 174362978) has the molecular formula C21H25N3O2S and a molecular weight of 383.52 g/mol. Its IUPAC name is N-[4-(1,3-benzothiazol-2-yl)phenyl]-4-[(1-hydroxy-2-methylpropyl)amino]butanamide.
| Compound Name | N-[4-(1,3-benzothiazol-2-yl)phenyl]-4-[(1-hydroxy-2-methylpropyl)amino]butanamide |
|---|---|
| PubChem CID | 174362978 |
| Molecular Formula | C21H25N3O2S |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | N-[4-(1,3-benzothiazol-2-yl)phenyl]-4-[(1-hydroxy-2-methylpropyl)amino]butanamide |
| SMILES | CC(C)C(O)NCCCC(=O)Nc1ccc(-c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C21H25N3O2S/c1-14(2)20(26)22-13-5-8-19(25)23-16-11-9-15(10-12-16)21-24-17-6-3-4-7-18(17)27-21/h3-4,6-7,9-12,14,20,22,26H,5,8,13H2,1-2H3,(H,23,25) |
| InChIKey | KUSFWJFKTCKKLZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|