C23H20N2O2S — CID 17359922
N-[4-(1,3-benzothiazol-2-yl)phenyl]-3-(4-methoxyphenyl)propanamide (PubChem CID 17359922) has the molecular formula C23H20N2O2S and a molecular weight of 388.49 g/mol. Its IUPAC name is N-[4-(1,3-benzothiazol-2-yl)phenyl]-3-(4-methoxyphenyl)propanamide.
| Compound Name | N-[4-(1,3-benzothiazol-2-yl)phenyl]-3-(4-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 17359922 |
| Molecular Formula | C23H20N2O2S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | N-[4-(1,3-benzothiazol-2-yl)phenyl]-3-(4-methoxyphenyl)propanamide |
| SMILES | COc1ccc(CCC(=O)Nc2ccc(-c3nc4ccccc4s3)cc2)cc1 |
| InChI | InChI=1S/C23H20N2O2S/c1-27-19-13-6-16(7-14-19)8-15-22(26)24-18-11-9-17(10-12-18)23-25-20-4-2-3-5-21(20)28-23/h2-7,9-14H,8,15H2,1H3,(H,24,26) |
| InChIKey | AYXSPEULIWPTCL-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |