C18H17BrN2OS — CID 68701204
N-[4-(1,3-benzothiazol-2-yl)phenyl]-5-bromopentanamide (PubChem CID 68701204) has the molecular formula C18H17BrN2OS and a molecular weight of 389.32 g/mol. Its IUPAC name is N-[4-(1,3-benzothiazol-2-yl)phenyl]-5-bromopentanamide.
| Compound Name | N-[4-(1,3-benzothiazol-2-yl)phenyl]-5-bromopentanamide |
|---|---|
| PubChem CID | 68701204 |
| Molecular Formula | C18H17BrN2OS |
| Molecular Weight | 389.32 g/mol |
| Exact Mass | 388.02 |
| IUPAC Name | N-[4-(1,3-benzothiazol-2-yl)phenyl]-5-bromopentanamide |
| SMILES | O=C(CCCCBr)Nc1ccc(-c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C18H17BrN2OS/c19-12-4-3-7-17(22)20-14-10-8-13(9-11-14)18-21-15-5-1-2-6-16(15)23-18/h1-2,5-6,8-11H,3-4,7,12H2,(H,20,22) |
| InChIKey | NJLRQZDCXIMXHB-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.32 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|