C20H16N2O2S2 — CID 51696287
(2R)-N-[3-(1,3-benzothiazol-2-yl)thiophen-2-yl]-2-phenoxypropanamide (PubChem CID 51696287) has the molecular formula C20H16N2O2S2 and a molecular weight of 380.49 g/mol. Its IUPAC name is (2R)-N-[3-(1,3-benzothiazol-2-yl)thiophen-2-yl]-2-phenoxypropanamide.
| Compound Name | (2R)-N-[3-(1,3-benzothiazol-2-yl)thiophen-2-yl]-2-phenoxypropanamide |
|---|---|
| PubChem CID | 51696287 |
| Molecular Formula | C20H16N2O2S2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | (2R)-N-[3-(1,3-benzothiazol-2-yl)thiophen-2-yl]-2-phenoxypropanamide |
| SMILES | C[C@@H](Oc1ccccc1)C(=O)Nc1sccc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C20H16N2O2S2/c1-13(24-14-7-3-2-4-8-14)18(23)22-19-15(11-12-25-19)20-21-16-9-5-6-10-17(16)26-20/h2-13H,1H3,(H,22,23)/t13-/m1/s1 |
| InChIKey | NWWMIPCVQJYDRP-CYBMUJFWSA-N |
| XLogP | 5.43 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |