C27H17N3S — CID 163686258
2-[4-(2-phenylquinazolin-4-yl)phenyl]-1,3-benzothiazole (PubChem CID 163686258) has the molecular formula C27H17N3S and a molecular weight of 415.52 g/mol. Its IUPAC name is 2-[4-(2-phenylquinazolin-4-yl)phenyl]-1,3-benzothiazole.
| Compound Name | 2-[4-(2-phenylquinazolin-4-yl)phenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 163686258 |
| Molecular Formula | C27H17N3S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 2-[4-(2-phenylquinazolin-4-yl)phenyl]-1,3-benzothiazole |
| SMILES | c1ccc(-c2nc(-c3ccc(-c4nc5ccccc5s4)cc3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C27H17N3S/c1-2-8-19(9-3-1)26-28-22-11-5-4-10-21(22)25(30-26)18-14-16-20(17-15-18)27-29-23-12-6-7-13-24(23)31-27/h1-17H |
| InChIKey | JPCWFRNXWPBWGP-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |