C19H23ClN6OS — CID 47065523
N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-2-[butyl(methyl)amino]-5-chloropyrimidine-4-carboxamide (PubChem CID 47065523) has the molecular formula C19H23ClN6OS and a molecular weight of 418.95 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-2-[butyl(methyl)amino]-5-chloropyrimidine-4-carboxamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-2-[butyl(methyl)amino]-5-chloropyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 47065523 |
| Molecular Formula | C19H23ClN6OS |
| Molecular Weight | 418.95 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-2-[butyl(methyl)amino]-5-chloropyrimidine-4-carboxamide |
| SMILES | CCCCN(C)c1ncc(Cl)c(C(=O)NCCNc2nc3ccccc3s2)n1 |
| InChI | InChI=1S/C19H23ClN6OS/c1-3-4-11-26(2)18-23-12-13(20)16(25-18)17(27)21-9-10-22-19-24-14-7-5-6-8-15(14)28-19/h5-8,12H,3-4,9-11H2,1-2H3,(H,21,27)(H,22,24) |
| InChIKey | RXNYGTCGIARZMC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.95 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|