C15H24N2O3S2 — CID 95322188
(2S)-N-[2-[(S)-benzylsulfinyl]ethyl]-2-methylpiperidine-1-sulfonamide (PubChem CID 95322188) has the molecular formula C15H24N2O3S2 and a molecular weight of 344.50 g/mol. Its IUPAC name is (2S)-N-[2-[(S)-benzylsulfinyl]ethyl]-2-methylpiperidine-1-sulfonamide.
| Compound Name | (2S)-N-[2-[(S)-benzylsulfinyl]ethyl]-2-methylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 95322188 |
| Molecular Formula | C15H24N2O3S2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | (2S)-N-[2-[(S)-benzylsulfinyl]ethyl]-2-methylpiperidine-1-sulfonamide |
| SMILES | C[C@H]1CCCCN1S(=O)(=O)NCC[S@@](=O)Cc1ccccc1 |
| InChI | InChI=1S/C15H24N2O3S2/c1-14-7-5-6-11-17(14)22(19,20)16-10-12-21(18)13-15-8-3-2-4-9-15/h2-4,8-9,14,16H,5-7,10-13H2,1H3/t14-,21+/m0/s1 |
| InChIKey | VXLSYUMSKAHCHW-LHSJRXKWSA-N |
| XLogP | 1.64 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |