C9H12N4O — CID 104901521
(2R)-N-pyridazin-3-ylpyrrolidine-2-carboxamide (PubChem CID 104901521) has the molecular formula C9H12N4O and a molecular weight of 192.22 g/mol. Its IUPAC name is (2R)-N-pyridazin-3-ylpyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-pyridazin-3-ylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 104901521 |
| Molecular Formula | C9H12N4O |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | (2R)-N-pyridazin-3-ylpyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1cccnn1)[C@H]1CCCN1 |
| InChI | InChI=1S/C9H12N4O/c14-9(7-3-1-5-10-7)12-8-4-2-6-11-13-8/h2,4,6-7,10H,1,3,5H2,(H,12,13,14)/t7-/m1/s1 |
| InChIKey | CIRPZBRERXVLDZ-SSDOTTSWSA-N |
| XLogP | 0.17 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |