C14H23Cl2N5O — CID 119879739
[4-(pyridazin-3-ylamino)piperidin-1-yl]-[(2S)-pyrrolidin-2-yl]methanone;dihydrochloride (PubChem CID 119879739) has the molecular formula C14H23Cl2N5O and a molecular weight of 348.28 g/mol. Its IUPAC name is [4-(pyridazin-3-ylamino)piperidin-1-yl]-[(2S)-pyrrolidin-2-yl]methanone;dihydrochloride.
| Compound Name | [4-(pyridazin-3-ylamino)piperidin-1-yl]-[(2S)-pyrrolidin-2-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 119879739 |
| Molecular Formula | C14H23Cl2N5O |
| Molecular Weight | 348.28 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | [4-(pyridazin-3-ylamino)piperidin-1-yl]-[(2S)-pyrrolidin-2-yl]methanone;dihydrochloride |
| SMILES | Cl.Cl.O=C([C@@H]1CCCN1)N1CCC(Nc2cccnn2)CC1 |
| InChI | InChI=1S/C14H21N5O.2ClH/c20-14(12-3-1-7-15-12)19-9-5-11(6-10-19)17-13-4-2-8-16-18-13;;/h2,4,8,11-12,15H,1,3,5-7,9-10H2,(H,17,18);2*1H/t12-;;/m0../s1 |
| InChIKey | BDXAKRKXNKZRKS-LTCKWSDVSA-N |
| XLogP | 1.48 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.28 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |