C18H24ClN5O — CID 122084290
2-amino-2-phenyl-1-[4-(pyridazin-3-ylamino)piperidin-1-yl]propan-1-one;hydrochloride (PubChem CID 122084290) has the molecular formula C18H24ClN5O and a molecular weight of 361.88 g/mol. Its IUPAC name is 2-amino-2-phenyl-1-[4-(pyridazin-3-ylamino)piperidin-1-yl]propan-1-one;hydrochloride.
| Compound Name | 2-amino-2-phenyl-1-[4-(pyridazin-3-ylamino)piperidin-1-yl]propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 122084290 |
| Molecular Formula | C18H24ClN5O |
| Molecular Weight | 361.88 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 2-amino-2-phenyl-1-[4-(pyridazin-3-ylamino)piperidin-1-yl]propan-1-one;hydrochloride |
| SMILES | CC(N)(C(=O)N1CCC(Nc2cccnn2)CC1)c1ccccc1.Cl |
| InChI | InChI=1S/C18H23N5O.ClH/c1-18(19,14-6-3-2-4-7-14)17(24)23-12-9-15(10-13-23)21-16-8-5-11-20-22-16;/h2-8,11,15H,9-10,12-13,19H2,1H3,(H,21,22);1H |
| InChIKey | ICJFXNVLQYVLTP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.88 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |