C15H20N6O — CID 95601742
(2S)-2-pyrazol-1-yl-1-[4-(pyridazin-3-ylamino)piperidin-1-yl]propan-1-one (PubChem CID 95601742) has the molecular formula C15H20N6O and a molecular weight of 300.37 g/mol. Its IUPAC name is (2S)-2-pyrazol-1-yl-1-[4-(pyridazin-3-ylamino)piperidin-1-yl]propan-1-one.
| Compound Name | (2S)-2-pyrazol-1-yl-1-[4-(pyridazin-3-ylamino)piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 95601742 |
| Molecular Formula | C15H20N6O |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | (2S)-2-pyrazol-1-yl-1-[4-(pyridazin-3-ylamino)piperidin-1-yl]propan-1-one |
| SMILES | C[C@@H](C(=O)N1CCC(Nc2cccnn2)CC1)n1cccn1 |
| InChI | InChI=1S/C15H20N6O/c1-12(21-9-3-8-17-21)15(22)20-10-5-13(6-11-20)18-14-4-2-7-16-19-14/h2-4,7-9,12-13H,5-6,10-11H2,1H3,(H,18,19)/t12-/m0/s1 |
| InChIKey | UAUULHNBRJXRHZ-LBPRGKRZSA-N |
| XLogP | 1.34 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |