C23H24ClN3O5S — CID 90105954
N-(5-benzyl-1,3,4-thiadiazol-2-yl)-3-chloro-4-cyclohexyloxybenzamide;carbonic acid (PubChem CID 90105954) has the molecular formula C23H24ClN3O5S and a molecular weight of 489.98 g/mol. Its IUPAC name is N-(5-benzyl-1,3,4-thiadiazol-2-yl)-3-chloro-4-cyclohexyloxybenzamide;carbonic acid.
| Compound Name | N-(5-benzyl-1,3,4-thiadiazol-2-yl)-3-chloro-4-cyclohexyloxybenzamide;carbonic acid |
|---|---|
| PubChem CID | 90105954 |
| Molecular Formula | C23H24ClN3O5S |
| Molecular Weight | 489.98 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | N-(5-benzyl-1,3,4-thiadiazol-2-yl)-3-chloro-4-cyclohexyloxybenzamide;carbonic acid |
| SMILES | O=C(Nc1nnc(Cc2ccccc2)s1)c1ccc(OC2CCCCC2)c(Cl)c1.O=C(O)O |
| InChI | InChI=1S/C22H22ClN3O2S.CH2O3/c23-18-14-16(11-12-19(18)28-17-9-5-2-6-10-17)21(27)24-22-26-25-20(29-22)13-15-7-3-1-4-8-15;2-1(3)4/h1,3-4,7-8,11-12,14,17H,2,5-6,9-10,13H2,(H,24,26,27);(H2,2,3,4) |
| InChIKey | SBIFZYCGLOQHHT-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 121.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.98 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |