C16H11ClFN3OS — CID 18075087
N-(5-benzyl-1,3,4-thiadiazol-2-yl)-2-chloro-4-fluorobenzamide (PubChem CID 18075087) has the molecular formula C16H11ClFN3OS and a molecular weight of 347.80 g/mol. Its IUPAC name is N-(5-benzyl-1,3,4-thiadiazol-2-yl)-2-chloro-4-fluorobenzamide.
| Compound Name | N-(5-benzyl-1,3,4-thiadiazol-2-yl)-2-chloro-4-fluorobenzamide |
|---|---|
| PubChem CID | 18075087 |
| Molecular Formula | C16H11ClFN3OS |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | N-(5-benzyl-1,3,4-thiadiazol-2-yl)-2-chloro-4-fluorobenzamide |
| SMILES | O=C(Nc1nnc(Cc2ccccc2)s1)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C16H11ClFN3OS/c17-13-9-11(18)6-7-12(13)15(22)19-16-21-20-14(23-16)8-10-4-2-1-3-5-10/h1-7,9H,8H2,(H,19,21,22) |
| InChIKey | MNAXOQGSQNSTPD-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |