C9H5ClFN3OS — CID 6469162
2-chloro-4-fluoro-N-(1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 6469162) has the molecular formula C9H5ClFN3OS and a molecular weight of 257.68 g/mol. Its IUPAC name is 2-chloro-4-fluoro-N-(1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 2-chloro-4-fluoro-N-(1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 6469162 |
| Molecular Formula | C9H5ClFN3OS |
| Molecular Weight | 257.68 g/mol |
| Exact Mass | 256.98 |
| IUPAC Name | 2-chloro-4-fluoro-N-(1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nncs1)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C9H5ClFN3OS/c10-7-3-5(11)1-2-6(7)8(15)13-9-14-12-4-16-9/h1-4H,(H,13,14,15) |
| InChIKey | MSYGWNGMMYMSSG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.68 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |