C9H6FN3O2S — CID 103940013
2-fluoro-4-hydroxy-N-(1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 103940013) has the molecular formula C9H6FN3O2S and a molecular weight of 239.23 g/mol. Its IUPAC name is 2-fluoro-4-hydroxy-N-(1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 2-fluoro-4-hydroxy-N-(1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 103940013 |
| Molecular Formula | C9H6FN3O2S |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.02 |
| IUPAC Name | 2-fluoro-4-hydroxy-N-(1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nncs1)c1ccc(O)cc1F |
| InChI | InChI=1S/C9H6FN3O2S/c10-7-3-5(14)1-2-6(7)8(15)12-9-13-11-4-16-9/h1-4,14H,(H,12,13,15) |
| InChIKey | WPFQYWXPEGXJMI-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |