C8H5FN4OS — CID 115496715
6-fluoro-N-(1,3,4-thiadiazol-2-yl)pyridine-2-carboxamide (PubChem CID 115496715) has the molecular formula C8H5FN4OS and a molecular weight of 224.22 g/mol. Its IUPAC name is 6-fluoro-N-(1,3,4-thiadiazol-2-yl)pyridine-2-carboxamide.
| Compound Name | 6-fluoro-N-(1,3,4-thiadiazol-2-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 115496715 |
| Molecular Formula | C8H5FN4OS |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | 6-fluoro-N-(1,3,4-thiadiazol-2-yl)pyridine-2-carboxamide |
| SMILES | O=C(Nc1nncs1)c1cccc(F)n1 |
| InChI | InChI=1S/C8H5FN4OS/c9-6-3-1-2-5(11-6)7(14)12-8-13-10-4-15-8/h1-4H,(H,12,13,14) |
| InChIKey | NBHXMLWNKKFTJV-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|