C11H7FN2O3S — CID 113323241
5-[(6-fluoropyridine-2-carbonyl)amino]thiophene-2-carboxylic acid (PubChem CID 113323241) has the molecular formula C11H7FN2O3S and a molecular weight of 266.25 g/mol. Its IUPAC name is 5-[(6-fluoropyridine-2-carbonyl)amino]thiophene-2-carboxylic acid.
| Compound Name | 5-[(6-fluoropyridine-2-carbonyl)amino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 113323241 |
| Molecular Formula | C11H7FN2O3S |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.02 |
| IUPAC Name | 5-[(6-fluoropyridine-2-carbonyl)amino]thiophene-2-carboxylic acid |
| SMILES | O=C(Nc1ccc(C(=O)O)s1)c1cccc(F)n1 |
| InChI | InChI=1S/C11H7FN2O3S/c12-8-3-1-2-6(13-8)10(15)14-9-5-4-7(18-9)11(16)17/h1-5H,(H,14,15)(H,16,17) |
| InChIKey | MFWMGQKQDKIOTA-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|