C10H7FN4O3 — CID 115496461
3-[(6-fluoropyridine-2-carbonyl)amino]-1H-pyrazole-5-carboxylic acid (PubChem CID 115496461) has the molecular formula C10H7FN4O3 and a molecular weight of 250.19 g/mol. Its IUPAC name is 3-[(6-fluoropyridine-2-carbonyl)amino]-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-[(6-fluoropyridine-2-carbonyl)amino]-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 115496461 |
| Molecular Formula | C10H7FN4O3 |
| Molecular Weight | 250.19 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 3-[(6-fluoropyridine-2-carbonyl)amino]-1H-pyrazole-5-carboxylic acid |
| SMILES | O=C(Nc1cc(C(=O)O)[nH]n1)c1cccc(F)n1 |
| InChI | InChI=1S/C10H7FN4O3/c11-7-3-1-2-5(12-7)9(16)13-8-4-6(10(17)18)14-15-8/h1-4H,(H,17,18)(H2,13,14,15,16) |
| InChIKey | MJBCEFVWLWFUOQ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.19 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|