C7H6N4OS — CID 130649691
N-(1,3,4-thiadiazol-2-yl)-1H-pyrrole-3-carboxamide (PubChem CID 130649691) has the molecular formula C7H6N4OS and a molecular weight of 194.22 g/mol. Its IUPAC name is N-(1,3,4-thiadiazol-2-yl)-1H-pyrrole-3-carboxamide.
| Compound Name | N-(1,3,4-thiadiazol-2-yl)-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 130649691 |
| Molecular Formula | C7H6N4OS |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | N-(1,3,4-thiadiazol-2-yl)-1H-pyrrole-3-carboxamide |
| SMILES | O=C(Nc1nncs1)c1cc[nH]c1 |
| InChI | InChI=1S/C7H6N4OS/c12-6(5-1-2-8-3-5)10-7-11-9-4-13-7/h1-4,8H,(H,10,11,12) |
| InChIKey | JIYBMEPATATMJV-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |