C8H6N4O2S — CID 29369768
1-oxido-N-(1,3,4-thiadiazol-2-yl)pyridin-1-ium-4-carboxamide (PubChem CID 29369768) has the molecular formula C8H6N4O2S and a molecular weight of 222.23 g/mol. Its IUPAC name is 1-oxido-N-(1,3,4-thiadiazol-2-yl)pyridin-1-ium-4-carboxamide.
| Compound Name | 1-oxido-N-(1,3,4-thiadiazol-2-yl)pyridin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 29369768 |
| Molecular Formula | C8H6N4O2S |
| Molecular Weight | 222.23 g/mol |
| Exact Mass | 222.02 |
| IUPAC Name | 1-oxido-N-(1,3,4-thiadiazol-2-yl)pyridin-1-ium-4-carboxamide |
| SMILES | O=C(Nc1nncs1)c1cc[n+]([O-])cc1 |
| InChI | InChI=1S/C8H6N4O2S/c13-7(10-8-11-9-5-15-8)6-1-3-12(14)4-2-6/h1-5H,(H,10,11,13) |
| InChIKey | XQWWGNYKJRFJOX-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 81.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.23 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|