C20H17ClN4O2S — CID 18200259
N-(5-benzyl-1,3,4-thiadiazol-2-yl)-4-chloro-3-(2-oxopyrrolidin-1-yl)benzamide (PubChem CID 18200259) has the molecular formula C20H17ClN4O2S and a molecular weight of 412.90 g/mol. Its IUPAC name is N-(5-benzyl-1,3,4-thiadiazol-2-yl)-4-chloro-3-(2-oxopyrrolidin-1-yl)benzamide.
| Compound Name | N-(5-benzyl-1,3,4-thiadiazol-2-yl)-4-chloro-3-(2-oxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 18200259 |
| Molecular Formula | C20H17ClN4O2S |
| Molecular Weight | 412.90 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | N-(5-benzyl-1,3,4-thiadiazol-2-yl)-4-chloro-3-(2-oxopyrrolidin-1-yl)benzamide |
| SMILES | O=C(Nc1nnc(Cc2ccccc2)s1)c1ccc(Cl)c(N2CCCC2=O)c1 |
| InChI | InChI=1S/C20H17ClN4O2S/c21-15-9-8-14(12-16(15)25-10-4-7-18(25)26)19(27)22-20-24-23-17(28-20)11-13-5-2-1-3-6-13/h1-3,5-6,8-9,12H,4,7,10-11H2,(H,22,24,27) |
| InChIKey | URNFYEHWLYMEHO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.90 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |