C18H21N3O3S — CID 11222117
4-[(2-cyclopentylacetyl)amino]-3-methoxy-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 11222117) has the molecular formula C18H21N3O3S and a molecular weight of 359.45 g/mol. Its IUPAC name is 4-[(2-cyclopentylacetyl)amino]-3-methoxy-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-[(2-cyclopentylacetyl)amino]-3-methoxy-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 11222117 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 4-[(2-cyclopentylacetyl)amino]-3-methoxy-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | COc1cc(C(=O)Nc2nccs2)ccc1NC(=O)CC1CCCC1 |
| InChI | InChI=1S/C18H21N3O3S/c1-24-15-11-13(17(23)21-18-19-8-9-25-18)6-7-14(15)20-16(22)10-12-4-2-3-5-12/h6-9,11-12H,2-5,10H2,1H3,(H,20,22)(H,19,21,23) |
| InChIKey | LYYACKDKAYJOAV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |