C20H25N3O3S — CID 142775316
4-[(2-cycloheptylacetyl)amino]-3-methoxy-2-(1,3-thiazol-2-yl)benzamide (PubChem CID 142775316) has the molecular formula C20H25N3O3S and a molecular weight of 387.51 g/mol. Its IUPAC name is 4-[(2-cycloheptylacetyl)amino]-3-methoxy-2-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-[(2-cycloheptylacetyl)amino]-3-methoxy-2-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 142775316 |
| Molecular Formula | C20H25N3O3S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 4-[(2-cycloheptylacetyl)amino]-3-methoxy-2-(1,3-thiazol-2-yl)benzamide |
| SMILES | COc1c(NC(=O)CC2CCCCCC2)ccc(C(N)=O)c1-c1nccs1 |
| InChI | InChI=1S/C20H25N3O3S/c1-26-18-15(23-16(24)12-13-6-4-2-3-5-7-13)9-8-14(19(21)25)17(18)20-22-10-11-27-20/h8-11,13H,2-7,12H2,1H3,(H2,21,25)(H,23,24) |
| InChIKey | OFQVQKGIPYFMBR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |