C24H26N2O3S — CID 41411582
4-(2-amino-2-oxoethoxy)-N-[(S)-(4-butylphenyl)-thiophen-2-ylmethyl]benzamide (PubChem CID 41411582) has the molecular formula C24H26N2O3S and a molecular weight of 422.55 g/mol. Its IUPAC name is 4-(2-amino-2-oxoethoxy)-N-[(S)-(4-butylphenyl)-thiophen-2-ylmethyl]benzamide.
| Compound Name | 4-(2-amino-2-oxoethoxy)-N-[(S)-(4-butylphenyl)-thiophen-2-ylmethyl]benzamide |
|---|---|
| PubChem CID | 41411582 |
| Molecular Formula | C24H26N2O3S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 4-(2-amino-2-oxoethoxy)-N-[(S)-(4-butylphenyl)-thiophen-2-ylmethyl]benzamide |
| SMILES | CCCCc1ccc([C@H](NC(=O)c2ccc(OCC(N)=O)cc2)c2cccs2)cc1 |
| InChI | InChI=1S/C24H26N2O3S/c1-2-3-5-17-7-9-18(10-8-17)23(21-6-4-15-30-21)26-24(28)19-11-13-20(14-12-19)29-16-22(25)27/h4,6-15,23H,2-3,5,16H2,1H3,(H2,25,27)(H,26,28)/t23-/m0/s1 |
| InChIKey | QFRCPHHVTJUEKO-QHCPKHFHSA-N |
| XLogP | 4.47 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |