C23H22N4OS — CID 24665671
6-imidazol-1-yl-N-[(4-propylphenyl)-thiophen-2-ylmethyl]pyridine-3-carboxamide (PubChem CID 24665671) has the molecular formula C23H22N4OS and a molecular weight of 402.52 g/mol. Its IUPAC name is 6-imidazol-1-yl-N-[(4-propylphenyl)-thiophen-2-ylmethyl]pyridine-3-carboxamide.
| Compound Name | 6-imidazol-1-yl-N-[(4-propylphenyl)-thiophen-2-ylmethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 24665671 |
| Molecular Formula | C23H22N4OS |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 6-imidazol-1-yl-N-[(4-propylphenyl)-thiophen-2-ylmethyl]pyridine-3-carboxamide |
| SMILES | CCCc1ccc(C(NC(=O)c2ccc(-n3ccnc3)nc2)c2cccs2)cc1 |
| InChI | InChI=1S/C23H22N4OS/c1-2-4-17-6-8-18(9-7-17)22(20-5-3-14-29-20)26-23(28)19-10-11-21(25-15-19)27-13-12-24-16-27/h3,5-16,22H,2,4H2,1H3,(H,26,28) |
| InChIKey | FAQOYCZQXPIUCO-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |