C25H25N3O3S — CID 24550451
1-ethyl-2,3-dioxo-N-[(4-propylphenyl)-thiophen-2-ylmethyl]-4H-quinoxaline-6-carboxamide (PubChem CID 24550451) has the molecular formula C25H25N3O3S and a molecular weight of 447.56 g/mol. Its IUPAC name is 1-ethyl-2,3-dioxo-N-[(4-propylphenyl)-thiophen-2-ylmethyl]-4H-quinoxaline-6-carboxamide.
| Compound Name | 1-ethyl-2,3-dioxo-N-[(4-propylphenyl)-thiophen-2-ylmethyl]-4H-quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 24550451 |
| Molecular Formula | C25H25N3O3S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 1-ethyl-2,3-dioxo-N-[(4-propylphenyl)-thiophen-2-ylmethyl]-4H-quinoxaline-6-carboxamide |
| SMILES | CCCc1ccc(C(NC(=O)c2ccc3c(c2)[nH]c(=O)c(=O)n3CC)c2cccs2)cc1 |
| InChI | InChI=1S/C25H25N3O3S/c1-3-6-16-8-10-17(11-9-16)22(21-7-5-14-32-21)27-23(29)18-12-13-20-19(15-18)26-24(30)25(31)28(20)4-2/h5,7-15,22H,3-4,6H2,1-2H3,(H,26,30)(H,27,29) |
| InChIKey | XYEJFZKJLZSXDW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|