C25H25N3O3S — CID 97098942
3-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]-N-[(S)-(4-propylphenyl)-thiophen-2-ylmethyl]benzamide (PubChem CID 97098942) has the molecular formula C25H25N3O3S and a molecular weight of 447.56 g/mol. Its IUPAC name is 3-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]-N-[(S)-(4-propylphenyl)-thiophen-2-ylmethyl]benzamide.
| Compound Name | 3-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]-N-[(S)-(4-propylphenyl)-thiophen-2-ylmethyl]benzamide |
|---|---|
| PubChem CID | 97098942 |
| Molecular Formula | C25H25N3O3S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 3-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]-N-[(S)-(4-propylphenyl)-thiophen-2-ylmethyl]benzamide |
| SMILES | CCCc1ccc([C@H](NC(=O)c2cccc([C@@]3(C)NC(=O)NC3=O)c2)c2cccs2)cc1 |
| InChI | InChI=1S/C25H25N3O3S/c1-3-6-16-10-12-17(13-11-16)21(20-9-5-14-32-20)26-22(29)18-7-4-8-19(15-18)25(2)23(30)27-24(31)28-25/h4-5,7-15,21H,3,6H2,1-2H3,(H,26,29)(H2,27,28,30,31)/t21-,25+/m0/s1 |
| InChIKey | GRZITYBQZWAXEH-SQJMNOBHSA-N |
| XLogP | 4.27 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|