C24H27NO3S — CID 18275719
N-[(4-butylphenyl)-thiophen-2-ylmethyl]-2-(4-methoxyphenoxy)acetamide (PubChem CID 18275719) has the molecular formula C24H27NO3S and a molecular weight of 409.55 g/mol. Its IUPAC name is N-[(4-butylphenyl)-thiophen-2-ylmethyl]-2-(4-methoxyphenoxy)acetamide.
| Compound Name | N-[(4-butylphenyl)-thiophen-2-ylmethyl]-2-(4-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 18275719 |
| Molecular Formula | C24H27NO3S |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | N-[(4-butylphenyl)-thiophen-2-ylmethyl]-2-(4-methoxyphenoxy)acetamide |
| SMILES | CCCCc1ccc(C(NC(=O)COc2ccc(OC)cc2)c2cccs2)cc1 |
| InChI | InChI=1S/C24H27NO3S/c1-3-4-6-18-8-10-19(11-9-18)24(22-7-5-16-29-22)25-23(26)17-28-21-14-12-20(27-2)13-15-21/h5,7-16,24H,3-4,6,17H2,1-2H3,(H,25,26) |
| InChIKey | OGSNBQLDOASFAU-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |