C15H18N2O3S2 — CID 8617065
N'-[4-[(2S)-butan-2-yl]phenyl]sulfonylthiophene-2-carbohydrazide (PubChem CID 8617065) has the molecular formula C15H18N2O3S2 and a molecular weight of 338.45 g/mol. Its IUPAC name is N'-[4-[(2S)-butan-2-yl]phenyl]sulfonylthiophene-2-carbohydrazide.
| Compound Name | N'-[4-[(2S)-butan-2-yl]phenyl]sulfonylthiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 8617065 |
| Molecular Formula | C15H18N2O3S2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | N'-[4-[(2S)-butan-2-yl]phenyl]sulfonylthiophene-2-carbohydrazide |
| SMILES | CC[C@H](C)c1ccc(S(=O)(=O)NNC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C15H18N2O3S2/c1-3-11(2)12-6-8-13(9-7-12)22(19,20)17-16-15(18)14-5-4-10-21-14/h4-11,17H,3H2,1-2H3,(H,16,18)/t11-/m0/s1 |
| InChIKey | ZXFOFIVAVCWBLQ-NSHDSACASA-N |
| XLogP | 2.88 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|